C17H28N4O3 — CID 3845022
1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 3845022) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)-4-piperidin-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 3845022 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | CCN1C(=O)CC(N2CCC(C(N)=O)(N3CCCCC3)CC2)C1=O |
| InChI | InChI=1S/C17H28N4O3/c1-2-21-14(22)12-13(15(21)23)19-10-6-17(7-11-19,16(18)24)20-8-4-3-5-9-20/h13H,2-12H2,1H3,(H2,18,24) |
| InChIKey | ZLDCFYPAOLYFBQ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|