C19H15N3O3S2 — CID 3847272
2-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 3847272) has the molecular formula C19H15N3O3S2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 2-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3847272 |
| Molecular Formula | C19H15N3O3S2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | 2-[3-(naphthalen-1-ylmethyl)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | O=C(CC1SC(=O)N(Cc2cccc3ccccc23)C1=O)Nc1nccs1 |
| InChI | InChI=1S/C19H15N3O3S2/c23-16(21-18-20-8-9-26-18)10-15-17(24)22(19(25)27-15)11-13-6-3-5-12-4-1-2-7-14(12)13/h1-9,15H,10-11H2,(H,20,21,23) |
| InChIKey | BJFIEJIFKXCBDR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|