C8H7BrN4O3 — CID 3847474
6-bromo-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one (PubChem CID 3847474) has the molecular formula C8H7BrN4O3 and a molecular weight of 287.07 g/mol. Its IUPAC name is 6-bromo-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one.
| Compound Name | 6-bromo-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 3847474 |
| Molecular Formula | C8H7BrN4O3 |
| Molecular Weight | 287.07 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | 6-bromo-1,3-dimethyl-5-nitroimidazo[4,5-b]pyridin-2-one |
| SMILES | Cn1c(=O)n(C)c2nc([N+](=O)[O-])c(Br)cc21 |
| InChI | InChI=1S/C8H7BrN4O3/c1-11-5-3-4(9)6(13(15)16)10-7(5)12(2)8(11)14/h3H,1-2H3 |
| InChIKey | NBESRZIJLLMQKX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.07 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|