C20H20BrN5O2 — CID 3848164
2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[1-(4-bromophenyl)ethylideneamino]acetamide (PubChem CID 3848164) has the molecular formula C20H20BrN5O2 and a molecular weight of 442.32 g/mol. Its IUPAC name is 2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[1-(4-bromophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[1-(4-bromophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 3848164 |
| Molecular Formula | C20H20BrN5O2 |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[1-(4-bromophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)CC1N=C(Cc2ccccc2)NNC1=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H20BrN5O2/c1-13(15-7-9-16(21)10-8-15)23-25-19(27)12-17-20(28)26-24-18(22-17)11-14-5-3-2-4-6-14/h2-10,17H,11-12H2,1H3,(H,22,24)(H,25,27)(H,26,28) |
| InChIKey | QANPRFVSHCYGDP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|