C19H20N6O2 — CID 56692101
2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[(E)-1-pyridin-3-ylethylideneamino]acetamide (PubChem CID 56692101) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[(E)-1-pyridin-3-ylethylideneamino]acetamide.
| Compound Name | 2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[(E)-1-pyridin-3-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 56692101 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(3-benzyl-6-oxo-2,5-dihydro-1H-1,2,4-triazin-5-yl)-N-[(E)-1-pyridin-3-ylethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CC1N=C(Cc2ccccc2)NNC1=O)c1cccnc1 |
| InChI | InChI=1S/C19H20N6O2/c1-13(15-8-5-9-20-12-15)22-24-18(26)11-16-19(27)25-23-17(21-16)10-14-6-3-2-4-7-14/h2-9,12,16H,10-11H2,1H3,(H,21,23)(H,24,26)(H,25,27)/b22-13+ |
| InChIKey | FZUOYLAUTIBBKG-LPYMAVHISA-N |
| XLogP | 0.96 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|