C17H23N3O5 — CID 38491111
N-[2-[4-(morpholine-4-carbonyl)piperidin-1-yl]-2-oxoethyl]furan-2-carboxamide (PubChem CID 38491111) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[2-[4-(morpholine-4-carbonyl)piperidin-1-yl]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | N-[2-[4-(morpholine-4-carbonyl)piperidin-1-yl]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 38491111 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[2-[4-(morpholine-4-carbonyl)piperidin-1-yl]-2-oxoethyl]furan-2-carboxamide |
| SMILES | O=C(NCC(=O)N1CCC(C(=O)N2CCOCC2)CC1)c1ccco1 |
| InChI | InChI=1S/C17H23N3O5/c21-15(12-18-16(22)14-2-1-9-25-14)19-5-3-13(4-6-19)17(23)20-7-10-24-11-8-20/h1-2,9,13H,3-8,10-12H2,(H,18,22) |
| InChIKey | OVGOHLQZOLTFIK-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |