C11H13Cl2N3O2 — CID 3850072
1-[(3,4-dichlorophenyl)methoxy]-3-(dimethylaminomethylidene)urea (PubChem CID 3850072) has the molecular formula C11H13Cl2N3O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methoxy]-3-(dimethylaminomethylidene)urea.
| Compound Name | 1-[(3,4-dichlorophenyl)methoxy]-3-(dimethylaminomethylidene)urea |
|---|---|
| PubChem CID | 3850072 |
| Molecular Formula | C11H13Cl2N3O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methoxy]-3-(dimethylaminomethylidene)urea |
| SMILES | CN(C)C=NC(=O)NOCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13Cl2N3O2/c1-16(2)7-14-11(17)15-18-6-8-3-4-9(12)10(13)5-8/h3-5,7H,6H2,1-2H3,(H,15,17) |
| InChIKey | UCZOOPPLUIDQPY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|