C21H24N2O5S — CID 3853725
5-[2-[(4-methoxyphenoxy)methyl]-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid (PubChem CID 3853725) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 5-[2-[(4-methoxyphenoxy)methyl]-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid.
| Compound Name | 5-[2-[(4-methoxyphenoxy)methyl]-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3853725 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 5-[2-[(4-methoxyphenoxy)methyl]-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid |
| SMILES | COCCCn1c(-c2csc(COc3ccc(OC)cc3)n2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C21H24N2O5S/c1-14-17(21(24)25)11-19(23(14)9-4-10-26-2)18-13-29-20(22-18)12-28-16-7-5-15(27-3)6-8-16/h5-8,11,13H,4,9-10,12H2,1-3H3,(H,24,25) |
| InChIKey | HDKQYQIHGRMOLQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|