C19H18F2N2O3S — CID 3326993
5-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid (PubChem CID 3326993) has the molecular formula C19H18F2N2O3S and a molecular weight of 392.43 g/mol. Its IUPAC name is 5-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid.
| Compound Name | 5-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3326993 |
| Molecular Formula | C19H18F2N2O3S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 5-[2-(2,4-difluorophenyl)-1,3-thiazol-4-yl]-1-(3-methoxypropyl)-2-methylpyrrole-3-carboxylic acid |
| SMILES | COCCCn1c(-c2csc(-c3ccc(F)cc3F)n2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C19H18F2N2O3S/c1-11-14(19(24)25)9-17(23(11)6-3-7-26-2)16-10-27-18(22-16)13-5-4-12(20)8-15(13)21/h4-5,8-10H,3,6-7H2,1-2H3,(H,24,25) |
| InChIKey | DLHPHKHOSANEHM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|