C15H11N3O5S2 — CID 38548418
(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 5-methylsulfanyl-2-nitrobenzoate (PubChem CID 38548418) has the molecular formula C15H11N3O5S2 and a molecular weight of 377.40 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 5-methylsulfanyl-2-nitrobenzoate.
| Compound Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 5-methylsulfanyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 38548418 |
| Molecular Formula | C15H11N3O5S2 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 5-methylsulfanyl-2-nitrobenzoate |
| SMILES | CSc1ccc([N+](=O)[O-])c(C(=O)OCc2noc(-c3cccs3)n2)c1 |
| InChI | InChI=1S/C15H11N3O5S2/c1-24-9-4-5-11(18(20)21)10(7-9)15(19)22-8-13-16-14(23-17-13)12-3-2-6-25-12/h2-7H,8H2,1H3 |
| InChIKey | NWBAPMYJVKQJSS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|