C14H9BrN2O3S — CID 55448997
(5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-bromobenzoate (PubChem CID 55448997) has the molecular formula C14H9BrN2O3S and a molecular weight of 365.21 g/mol. Its IUPAC name is (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-bromobenzoate.
| Compound Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-bromobenzoate |
|---|---|
| PubChem CID | 55448997 |
| Molecular Formula | C14H9BrN2O3S |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | (5-thiophen-2-yl-1,2,4-oxadiazol-3-yl)methyl 4-bromobenzoate |
| SMILES | O=C(OCc1noc(-c2cccs2)n1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H9BrN2O3S/c15-10-5-3-9(4-6-10)14(18)19-8-12-16-13(20-17-12)11-2-1-7-21-11/h1-7H,8H2 |
| InChIKey | MSOKEJQOVWJACX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |