C21H26BrN6O5P — CID 3857893
N'-(4-bromophenyl)-1-dimorpholin-4-ylphosphoryl-N-(4-nitroanilino)methanimidamide (PubChem CID 3857893) has the molecular formula C21H26BrN6O5P and a molecular weight of 553.35 g/mol. Its IUPAC name is N'-(4-bromophenyl)-1-dimorpholin-4-ylphosphoryl-N-(4-nitroanilino)methanimidamide.
| Compound Name | N'-(4-bromophenyl)-1-dimorpholin-4-ylphosphoryl-N-(4-nitroanilino)methanimidamide |
|---|---|
| PubChem CID | 3857893 |
| Molecular Formula | C21H26BrN6O5P |
| Molecular Weight | 553.35 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | N'-(4-bromophenyl)-1-dimorpholin-4-ylphosphoryl-N-(4-nitroanilino)methanimidamide |
| SMILES | O=[N+]([O-])c1ccc(NN/C(=N\c2ccc(Br)cc2)P(=O)(N2CCOCC2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26BrN6O5P/c22-17-1-3-18(4-2-17)23-21(25-24-19-5-7-20(8-6-19)28(29)30)34(31,26-9-13-32-14-10-26)27-11-15-33-16-12-27/h1-8,24H,9-16H2,(H,23,25) |
| InChIKey | LXPNQOXLHHFABO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|