C17H14N4O2S3 — CID 3859088
2-oxo-N-[2-(pyridin-3-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-1,3-thiazolidine-4-carboxamide (PubChem CID 3859088) has the molecular formula C17H14N4O2S3 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-oxo-N-[2-(pyridin-3-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-oxo-N-[2-(pyridin-3-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 3859088 |
| Molecular Formula | C17H14N4O2S3 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 2-oxo-N-[2-(pyridin-3-ylmethylsulfanyl)-1,3-benzothiazol-6-yl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)Nc2ccc3nc(SCc4cccnc4)sc3c2)CS1 |
| InChI | InChI=1S/C17H14N4O2S3/c22-15(13-9-24-16(23)20-13)19-11-3-4-12-14(6-11)26-17(21-12)25-8-10-2-1-5-18-7-10/h1-7,13H,8-9H2,(H,19,22)(H,20,23) |
| InChIKey | BSIUZYLMWMFTHQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|