C23H25N3O4S2 — CID 3860355
1-[2-(2,5-dimethoxyphenyl)ethyl]-3-[(4-phenylphenyl)sulfonylamino]thiourea (PubChem CID 3860355) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-[(4-phenylphenyl)sulfonylamino]thiourea.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-[(4-phenylphenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 3860355 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)ethyl]-3-[(4-phenylphenyl)sulfonylamino]thiourea |
| SMILES | COc1ccc(OC)c(CCNC(=S)NNS(=O)(=O)c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-29-20-10-13-22(30-2)19(16-20)14-15-24-23(31)25-26-32(27,28)21-11-8-18(9-12-21)17-6-4-3-5-7-17/h3-13,16,26H,14-15H2,1-2H3,(H2,24,25,31) |
| InChIKey | NPVYWVFRMQIJFP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|