About 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide
2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide (PubChem CID 38639522) has the molecular formula C19H14ClN3O2S
and a molecular weight of 383.86 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide.
Molecular Properties
| Compound Name | 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide |
| PubChem CID | 38639522 |
| Molecular Formula | C19H14ClN3O2S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide |
| SMILES | N#Cc1ccc(NC(=O)CSCc2coc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H14ClN3O2S/c20-15-5-3-14(4-6-15)19-23-17(10-25-19)11-26-12-18(24)22-16-7-1-13(9-21)2-8-16/h1-8,10H,11-12H2,(H,22,24) |
| InChIKey | WCXXWWQIXZXXLS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide?
The IUPAC name of 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide (CID 38639522) is 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide.
What is the SMILES notation for 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide?
The canonical SMILES for 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide is N#Cc1ccc(NC(=O)CSCc2coc(-c3ccc(Cl)cc3)n2)cc1.
What is the InChIKey of 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide?
The InChIKey is WCXXWWQIXZXXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3O2S/c20-15-5-3-14(4-6-15)19-23-17(10-25-19)11-26-12-18(24)22-16-7-1-13(9-21)2-8-16/h1-8,10H,11-12H2,(H,22,24).
What are the key properties of 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide?
2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide has a molecular weight of 383.86 g/mol, XLogP of 4.74, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(4-cyanophenyl)acetamide is sourced from PubChem (CID 38639522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).