C19H15Cl3N2O3S — CID 38640368
2-[[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 38640368) has the molecular formula C19H15Cl3N2O3S and a molecular weight of 457.77 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 38640368 |
| Molecular Formula | C19H15Cl3N2O3S |
| Molecular Weight | 457.77 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | COc1ccc(-c2nc(CSCC(=O)Nc3cc(Cl)c(Cl)cc3Cl)co2)cc1 |
| InChI | InChI=1S/C19H15Cl3N2O3S/c1-26-13-4-2-11(3-5-13)19-23-12(8-27-19)9-28-10-18(25)24-17-7-15(21)14(20)6-16(17)22/h2-8H,9-10H2,1H3,(H,24,25) |
| InChIKey | KBOVSTZOYINTDR-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.77 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|