C15H15ClN2O2S — CID 38639607
2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-prop-2-enylacetamide (PubChem CID 38639607) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 38639607 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSCc1coc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C15H15ClN2O2S/c1-2-7-17-14(19)10-21-9-13-8-20-15(18-13)11-3-5-12(16)6-4-11/h2-6,8H,1,7,9-10H2,(H,17,19) |
| InChIKey | JJTFJMYQNRNLRU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|