C18H20N2O4 — CID 3864005
4,6-dioxo-1-(2-phenylethenyl)-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 3864005) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4,6-dioxo-1-(2-phenylethenyl)-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 4,6-dioxo-1-(2-phenylethenyl)-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 3864005 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4,6-dioxo-1-(2-phenylethenyl)-3-propan-2-yl-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)C1(C(=O)O)NC(C=Cc2ccccc2)C2C(=O)NC(=O)C21 |
| InChI | InChI=1S/C18H20N2O4/c1-10(2)18(17(23)24)14-13(15(21)19-16(14)22)12(20-18)9-8-11-6-4-3-5-7-11/h3-10,12-14,20H,1-2H3,(H,23,24)(H,19,21,22) |
| InChIKey | HLWQXYJMOKOBTG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|