C25H27N3O5 — CID 3864761
1-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea (PubChem CID 3864761) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea.
| Compound Name | 1-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
|---|---|
| PubChem CID | 3864761 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 1-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-3-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]urea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)NNC(=O)COc2ccc3c(C)cc(=O)oc3c2)c1 |
| InChI | InChI=1S/C25H27N3O5/c1-15(2)17-7-6-8-18(12-17)25(4,5)26-24(31)28-27-22(29)14-32-19-9-10-20-16(3)11-23(30)33-21(20)13-19/h6-13H,1,14H2,2-5H3,(H,27,29)(H2,26,28,31) |
| InChIKey | NYUGMZAAEIZQRS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|