C16H19N3OS2 — CID 3865748
3-(2-ethylsulfanylethyl)-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazolidin-4-one (PubChem CID 3865748) has the molecular formula C16H19N3OS2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-ethylsulfanylethyl)-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3865748 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)-2-(2-phenyl-1H-imidazol-5-yl)-1,3-thiazolidin-4-one |
| SMILES | CCSCCN1C(=O)CSC1c1cnc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C16H19N3OS2/c1-2-21-9-8-19-14(20)11-22-16(19)13-10-17-15(18-13)12-6-4-3-5-7-12/h3-7,10,16H,2,8-9,11H2,1H3,(H,17,18) |
| InChIKey | XQETYINFHBMBNJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|