C16H17N3O4S — CID 3868117
2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-(2-oxothiolan-3-yl)-1,3-oxazole-4-carboxamide (PubChem CID 3868117) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-(2-oxothiolan-3-yl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-(2-oxothiolan-3-yl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3868117 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-(2-oxothiolan-3-yl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(Cc1ccc(O)cc1)c1nc(C(=O)NC2CCSC2=O)co1 |
| InChI | InChI=1S/C16H17N3O4S/c17-11(7-9-1-3-10(20)4-2-9)15-19-13(8-23-15)14(21)18-12-5-6-24-16(12)22/h1-4,8,11-12,20H,5-7,17H2,(H,18,21) |
| InChIKey | BGULIFVPWLVELW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|