C20H20N4O7S — CID 3868260
N-[2-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 3868260) has the molecular formula C20H20N4O7S and a molecular weight of 460.47 g/mol. Its IUPAC name is N-[2-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3868260 |
| Molecular Formula | C20H20N4O7S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-[2-[2-(2-methylsulfonylbenzoyl)pyrazolidin-1-yl]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)N1CCCN1C(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H20N4O7S/c1-32(30,31)17-6-3-2-5-16(17)20(27)23-12-4-11-22(23)18(25)13-21-19(26)14-7-9-15(10-8-14)24(28)29/h2-3,5-10H,4,11-13H2,1H3,(H,21,26) |
| InChIKey | JHWQHZIQNDKOHY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 147.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|