C19H19N5O8S — CID 6733910
N-[2-[[2-[2-(2-methylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 6733910) has the molecular formula C19H19N5O8S and a molecular weight of 477.46 g/mol. Its IUPAC name is N-[2-[[2-[2-(2-methylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[[2-[2-(2-methylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 6733910 |
| Molecular Formula | C19H19N5O8S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | N-[2-[[2-[2-(2-methylsulfonylbenzoyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | CS(=O)(=O)c1ccccc1C(=O)NNC(=O)CNC(=O)CNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N5O8S/c1-33(31,32)15-5-3-2-4-14(15)19(28)23-22-17(26)11-20-16(25)10-21-18(27)12-6-8-13(9-7-12)24(29)30/h2-9H,10-11H2,1H3,(H,20,25)(H,21,27)(H,22,26)(H,23,28) |
| InChIKey | VVJSQGUCZYBYER-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 193.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|