C13H14F4N4O2 — CID 38708900
cis-(1R,2S)-2-methyl-N-[3-oxo-3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)hydrazinyl]propyl]cyclopropane-1-carboxamide (PubChem CID 38708900) has the molecular formula C13H14F4N4O2 and a molecular weight of 334.27 g/mol. Its IUPAC name is cis-(1R,2S)-2-methyl-N-[3-oxo-3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)hydrazinyl]propyl]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-methyl-N-[3-oxo-3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)hydrazinyl]propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 38708900 |
| Molecular Formula | C13H14F4N4O2 |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | cis-(1R,2S)-2-methyl-N-[3-oxo-3-[2-(2,3,5,6-tetrafluoro-4-pyridinyl)hydrazinyl]propyl]cyclopropane-1-carboxamide |
| SMILES | C[C@H]1C[C@H]1C(=O)NCCC(=O)NNc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H14F4N4O2/c1-5-4-6(5)13(23)18-3-2-7(22)20-21-10-8(14)11(16)19-12(17)9(10)15/h5-6H,2-4H2,1H3,(H,18,23)(H,19,21)(H,20,22)/t5-,6+/m0/s1 |
| InChIKey | FFNXQPWPDCBDSB-NTSWFWBYSA-N |
| XLogP | 1.24 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|