C11H13F4N3O — CID 103749974
N,2-dimethyl-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide (PubChem CID 103749974) has the molecular formula C11H13F4N3O and a molecular weight of 279.24 g/mol. Its IUPAC name is N,2-dimethyl-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide.
| Compound Name | N,2-dimethyl-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 103749974 |
| Molecular Formula | C11H13F4N3O |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N,2-dimethyl-3-[methyl-(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide |
| SMILES | CNC(=O)C(C)CN(C)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C11H13F4N3O/c1-5(11(19)16-2)4-18(3)8-6(12)9(14)17-10(15)7(8)13/h5H,4H2,1-3H3,(H,16,19) |
| InChIKey | AAPJZRRFNOWRDO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|