C10H8F4N2O — CID 135031370
N-prop-2-enyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide (PubChem CID 135031370) has the molecular formula C10H8F4N2O and a molecular weight of 248.18 g/mol. Its IUPAC name is N-prop-2-enyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide.
| Compound Name | N-prop-2-enyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
|---|---|
| PubChem CID | 135031370 |
| Molecular Formula | C10H8F4N2O |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | N-prop-2-enyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
| SMILES | C=CCN(C(C)=O)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C10H8F4N2O/c1-3-4-16(5(2)17)8-6(11)9(13)15-10(14)7(8)12/h3H,1,4H2,2H3 |
| InChIKey | KCWWBZSVIBINLT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|