C17H22N2O4S3 — CID 3871289
4-(2-methylpiperidin-1-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 3871289) has the molecular formula C17H22N2O4S3 and a molecular weight of 414.57 g/mol. Its IUPAC name is 4-(2-methylpiperidin-1-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(2-methylpiperidin-1-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3871289 |
| Molecular Formula | C17H22N2O4S3 |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 4-(2-methylpiperidin-1-yl)sulfonyl-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(S(=O)(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C17H22N2O4S3/c1-14-5-2-3-11-19(14)26(22,23)17-9-7-16(8-10-17)25(20,21)18-13-15-6-4-12-24-15/h4,6-10,12,14,18H,2-3,5,11,13H2,1H3 |
| InChIKey | AAGVWUJPXBMCMG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |