C20H18N2O3S — CID 38738978
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-benzyl-1,3-thiazole-4-carboxamide (PubChem CID 38738978) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-benzyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-benzyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 38738978 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-benzyl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)c1csc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C20H18N2O3S/c23-20(16-12-26-19(22-16)11-14-4-2-1-3-5-14)21-9-8-15-6-7-17-18(10-15)25-13-24-17/h1-7,10,12H,8-9,11,13H2,(H,21,23) |
| InChIKey | KNEJQPXBPIDEGG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |