C21H28N2O7S — CID 3875386
methyl 4-[[4,5-dihydroxy-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]cyclohexene-1-carbonyl]amino]butanoate (PubChem CID 3875386) has the molecular formula C21H28N2O7S and a molecular weight of 452.53 g/mol. Its IUPAC name is methyl 4-[[4,5-dihydroxy-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]cyclohexene-1-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[4,5-dihydroxy-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]cyclohexene-1-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 3875386 |
| Molecular Formula | C21H28N2O7S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | methyl 4-[[4,5-dihydroxy-3-[(2-methoxy-4-methylsulfanylbenzoyl)amino]cyclohexene-1-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C1=CC(NC(=O)c2ccc(SC)cc2OC)C(O)C(O)C1 |
| InChI | InChI=1S/C21H28N2O7S/c1-29-17-11-13(31-3)6-7-14(17)21(28)23-15-9-12(10-16(24)19(15)26)20(27)22-8-4-5-18(25)30-2/h6-7,9,11,15-16,19,24,26H,4-5,8,10H2,1-3H3,(H,22,27)(H,23,28) |
| InChIKey | WKDREEBHQRDSQK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|