C21H27N3O6S — CID 3878398
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-nitro-4-pyrrolidin-1-ylsulfonylaniline (PubChem CID 3878398) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-nitro-4-pyrrolidin-1-ylsulfonylaniline.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 3878398 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-2-nitro-4-pyrrolidin-1-ylsulfonylaniline |
| SMILES | COc1ccc(CCN(C)c2ccc(S(=O)(=O)N3CCCC3)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H27N3O6S/c1-22(13-10-16-6-9-20(29-2)21(14-16)30-3)18-8-7-17(15-19(18)24(25)26)31(27,28)23-11-4-5-12-23/h6-9,14-15H,4-5,10-13H2,1-3H3 |
| InChIKey | APDYFAAMAXXIBS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|