C24H20ClN5OS2 — CID 3881957
6-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3881957) has the molecular formula C24H20ClN5OS2 and a molecular weight of 494.05 g/mol. Its IUPAC name is 6-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3881957 |
| Molecular Formula | C24H20ClN5OS2 |
| Molecular Weight | 494.05 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 6-[[1-(3-chloro-2-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-5-imino-2-(thiophen-2-ylmethyl)-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cc(C)n(-c3cccc(Cl)c3C)c2C)C(=O)N=C2SC(Cc3cccs3)=NN21 |
| InChI | InChI=1S/C24H20ClN5OS2/c1-13-10-16(15(3)29(13)20-8-4-7-19(25)14(20)2)11-18-22(26)30-24(27-23(18)31)33-21(28-30)12-17-6-5-9-32-17/h4-11,26H,12H2,1-3H3/b18-11?,26-22- |
| InChIKey | CMRGVFJFUJIIKX-BNOFPNIFSA-N |
| XLogP | 5.98 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.05 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|