C23H29N5O2 — CID 3887184
3-[azepan-1-yl-(1-cyclopentyltetrazol-5-yl)methyl]-6-methylchromen-4-one (PubChem CID 3887184) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 3-[azepan-1-yl-(1-cyclopentyltetrazol-5-yl)methyl]-6-methylchromen-4-one.
| Compound Name | 3-[azepan-1-yl-(1-cyclopentyltetrazol-5-yl)methyl]-6-methylchromen-4-one |
|---|---|
| PubChem CID | 3887184 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-[azepan-1-yl-(1-cyclopentyltetrazol-5-yl)methyl]-6-methylchromen-4-one |
| SMILES | Cc1ccc2occ(C(c3nnnn3C3CCCC3)N3CCCCCC3)c(=O)c2c1 |
| InChI | InChI=1S/C23H29N5O2/c1-16-10-11-20-18(14-16)22(29)19(15-30-20)21(27-12-6-2-3-7-13-27)23-24-25-26-28(23)17-8-4-5-9-17/h10-11,14-15,17,21H,2-9,12-13H2,1H3 |
| InChIKey | YPHUCDSMTTVQOM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |