About 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide
4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide (PubChem CID 3887268) has the molecular formula C16H12Cl3N5O2
and a molecular weight of 412.66 g/mol. Its IUPAC name is 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide |
| PubChem CID | 3887268 |
| Molecular Formula | C16H12Cl3N5O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide |
| SMILES | CCn1c(O)c(/N=N/C(=O)c2nc(Cl)c(Cl)c(N)c2Cl)c2ccccc21 |
| InChI | InChI=1S/C16H12Cl3N5O2/c1-2-24-8-6-4-3-5-7(8)12(16(24)26)22-23-15(25)13-9(17)11(20)10(18)14(19)21-13/h3-6,26H,2H2,1H3,(H2,20,21)/b23-22+ |
| InChIKey | YWVWWVTVLQBEKD-GHVJWSGMSA-N |
| XLogP | 5.23 |
| TPSA | 105.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide?
The IUPAC name of 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide (CID 3887268) is 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide.
What is the SMILES notation for 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide?
The canonical SMILES for 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide is CCn1c(O)c(/N=N/C(=O)c2nc(Cl)c(Cl)c(N)c2Cl)c2ccccc21.
What is the InChIKey of 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide?
The InChIKey is YWVWWVTVLQBEKD-GHVJWSGMSA-N. The full InChI is InChI=1S/C16H12Cl3N5O2/c1-2-24-8-6-4-3-5-7(8)12(16(24)26)22-23-15(25)13-9(17)11(20)10(18)14(19)21-13/h3-6,26H,2H2,1H3,(H2,20,21)/b23-22+.
What are the key properties of 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide?
4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide has a molecular weight of 412.66 g/mol, XLogP of 5.23, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,5,6-trichloro-N-(1-ethyl-2-hydroxyindol-3-yl)iminopyridine-2-carboxamide is sourced from PubChem (CID 3887268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).