C16H20N4O5 — CID 3887440
3-morpholin-4-yl-N'-[3-(3-nitrophenyl)prop-2-enoyl]propanehydrazide (PubChem CID 3887440) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-morpholin-4-yl-N'-[3-(3-nitrophenyl)prop-2-enoyl]propanehydrazide.
| Compound Name | 3-morpholin-4-yl-N'-[3-(3-nitrophenyl)prop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 3887440 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-morpholin-4-yl-N'-[3-(3-nitrophenyl)prop-2-enoyl]propanehydrazide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)NNC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C16H20N4O5/c21-15(5-4-13-2-1-3-14(12-13)20(23)24)17-18-16(22)6-7-19-8-10-25-11-9-19/h1-5,12H,6-11H2,(H,17,21)(H,18,22) |
| InChIKey | OBMNMPNPSWWRAD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|