C24H27N3O2S — CID 3887660
3-cyclopentyl-N-[3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide (PubChem CID 3887660) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 3-cyclopentyl-N-[3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide.
| Compound Name | 3-cyclopentyl-N-[3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 3887660 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-cyclopentyl-N-[3-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]phenyl]propanamide |
| SMILES | COc1cccc(Nc2nc(-c3cccc(NC(=O)CCC4CCCC4)c3)cs2)c1 |
| InChI | InChI=1S/C24H27N3O2S/c1-29-21-11-5-10-20(15-21)26-24-27-22(16-30-24)18-8-4-9-19(14-18)25-23(28)13-12-17-6-2-3-7-17/h4-5,8-11,14-17H,2-3,6-7,12-13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | JYEKYULCWVIPBI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |