C21H14Cl2N2O4 — CID 38884818
N-[4-[(4E)-4-[(6,8-dichloro-2H-chromen-3-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide (PubChem CID 38884818) has the molecular formula C21H14Cl2N2O4 and a molecular weight of 429.26 g/mol. Its IUPAC name is N-[4-[(4E)-4-[(6,8-dichloro-2H-chromen-3-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(4E)-4-[(6,8-dichloro-2H-chromen-3-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 38884818 |
| Molecular Formula | C21H14Cl2N2O4 |
| Molecular Weight | 429.26 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | N-[4-[(4E)-4-[(6,8-dichloro-2H-chromen-3-yl)methylidene]-5-oxo-1,3-oxazol-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=N/C(=C/C3=Cc4cc(Cl)cc(Cl)c4OC3)C(=O)O2)cc1 |
| InChI | InChI=1S/C21H14Cl2N2O4/c1-11(26)24-16-4-2-13(3-5-16)20-25-18(21(27)29-20)7-12-6-14-8-15(22)9-17(23)19(14)28-10-12/h2-9H,10H2,1H3,(H,24,26)/b18-7+ |
| InChIKey | SUJHXHIOMCWREH-CNHKJKLMSA-N |
| XLogP | 4.62 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.26 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|