C14H14Cl2N2OS — CID 38886003
N-(2,5-dichlorophenyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 38886003) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 38886003 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(2-propan-2-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CC(C)c1nc(CC(=O)Nc2cc(Cl)ccc2Cl)cs1 |
| InChI | InChI=1S/C14H14Cl2N2OS/c1-8(2)14-17-10(7-20-14)6-13(19)18-12-5-9(15)3-4-11(12)16/h3-5,7-8H,6H2,1-2H3,(H,18,19) |
| InChIKey | BSFGWHMQVNHMHC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |