C15H14F2N2O3S — CID 38893186
3-(N-(3,5-difluorophenyl)sulfonylanilino)propanamide (PubChem CID 38893186) has the molecular formula C15H14F2N2O3S and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-(N-(3,5-difluorophenyl)sulfonylanilino)propanamide.
| Compound Name | 3-(N-(3,5-difluorophenyl)sulfonylanilino)propanamide |
|---|---|
| PubChem CID | 38893186 |
| Molecular Formula | C15H14F2N2O3S |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-(N-(3,5-difluorophenyl)sulfonylanilino)propanamide |
| SMILES | NC(=O)CCN(c1ccccc1)S(=O)(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H14F2N2O3S/c16-11-8-12(17)10-14(9-11)23(21,22)19(7-6-15(18)20)13-4-2-1-3-5-13/h1-5,8-10H,6-7H2,(H2,18,20) |
| InChIKey | NJWMDANKZUEQEN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |