C15H17FN2O4S — CID 75445266
3-(N-(2,5-dimethylfuran-3-yl)sulfonyl-4-fluoroanilino)propanamide (PubChem CID 75445266) has the molecular formula C15H17FN2O4S and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-(N-(2,5-dimethylfuran-3-yl)sulfonyl-4-fluoroanilino)propanamide.
| Compound Name | 3-(N-(2,5-dimethylfuran-3-yl)sulfonyl-4-fluoroanilino)propanamide |
|---|---|
| PubChem CID | 75445266 |
| Molecular Formula | C15H17FN2O4S |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-(N-(2,5-dimethylfuran-3-yl)sulfonyl-4-fluoroanilino)propanamide |
| SMILES | Cc1cc(S(=O)(=O)N(CCC(N)=O)c2ccc(F)cc2)c(C)o1 |
| InChI | InChI=1S/C15H17FN2O4S/c1-10-9-14(11(2)22-10)23(20,21)18(8-7-15(17)19)13-5-3-12(16)4-6-13/h3-6,9H,7-8H2,1-2H3,(H2,17,19) |
| InChIKey | ZLBSIBWPOJTFKR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |