C17H14F4INO2 — CID 38905531
4-fluoro-2-iodo-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 38905531) has the molecular formula C17H14F4INO2 and a molecular weight of 467.20 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-fluoro-2-iodo-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 38905531 |
| Molecular Formula | C17H14F4INO2 |
| Molecular Weight | 467.20 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 4-fluoro-2-iodo-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)c1ccc(F)cc1I |
| InChI | InChI=1S/C17H14F4INO2/c1-2-7-25-15-6-3-10(17(19,20)21)8-14(15)23-16(24)12-5-4-11(18)9-13(12)22/h3-6,8-9H,2,7H2,1H3,(H,23,24) |
| InChIKey | DKDVFHVGQCLAKF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.20 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|