C19H19F4NO4S — CID 55811519
2-(4-fluorophenyl)sulfonyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 55811519) has the molecular formula C19H19F4NO4S and a molecular weight of 433.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 55811519 |
| Molecular Formula | C19H19F4NO4S |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-N-[2-propoxy-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)C(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F4NO4S/c1-3-10-28-17-9-4-13(19(21,22)23)11-16(17)24-18(25)12(2)29(26,27)15-7-5-14(20)6-8-15/h4-9,11-12H,3,10H2,1-2H3,(H,24,25) |
| InChIKey | FWMLUBFTQQWPJK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |