C20H23F3N2O5S — CID 55524220
4-(2-methoxyethylsulfamoyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 55524220) has the molecular formula C20H23F3N2O5S and a molecular weight of 460.47 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 55524220 |
| Molecular Formula | C20H23F3N2O5S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-[2-propoxy-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCCOc1ccc(C(F)(F)F)cc1NC(=O)c1ccc(S(=O)(=O)NCCOC)cc1 |
| InChI | InChI=1S/C20H23F3N2O5S/c1-3-11-30-18-9-6-15(20(21,22)23)13-17(18)25-19(26)14-4-7-16(8-5-14)31(27,28)24-10-12-29-2/h4-9,13,24H,3,10-12H2,1-2H3,(H,25,26) |
| InChIKey | BRESPSOQKDMRRG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|