C16H14Cl2FNO — CID 38912265
3-(2,3-dichlorophenyl)-N-(4-fluoro-2-methylphenyl)propanamide (PubChem CID 38912265) has the molecular formula C16H14Cl2FNO and a molecular weight of 326.20 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-N-(4-fluoro-2-methylphenyl)propanamide.
| Compound Name | 3-(2,3-dichlorophenyl)-N-(4-fluoro-2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 38912265 |
| Molecular Formula | C16H14Cl2FNO |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-N-(4-fluoro-2-methylphenyl)propanamide |
| SMILES | Cc1cc(F)ccc1NC(=O)CCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H14Cl2FNO/c1-10-9-12(19)6-7-14(10)20-15(21)8-5-11-3-2-4-13(17)16(11)18/h2-4,6-7,9H,5,8H2,1H3,(H,20,21) |
| InChIKey | RYDLGWKDJSZEQD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |