C31H35ClFN3O4S — CID 3893063
2-[2-chloro-4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 3893063) has the molecular formula C31H35ClFN3O4S and a molecular weight of 600.16 g/mol. Its IUPAC name is 2-[2-chloro-4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 3893063 |
| Molecular Formula | C31H35ClFN3O4S |
| Molecular Weight | 600.16 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | 2-[2-chloro-4-[(3-cyclohexyl-2-cyclohexylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc(C=C2S/C(=N\C3CCCCC3)N(C3CCCCC3)C2=O)cc(Cl)c1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C31H35ClFN3O4S/c1-39-26-17-20(16-25(32)29(26)40-19-28(37)34-23-14-12-21(33)13-15-23)18-27-30(38)36(24-10-6-3-7-11-24)31(41-27)35-22-8-4-2-5-9-22/h12-18,22,24H,2-11,19H2,1H3,(H,34,37)/b27-18?,35-31- |
| InChIKey | QSBASCKQGWWQNX-DINGEMSNSA-N |
| XLogP | 7.44 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.16 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|