C17H19NO5S — CID 38934348
methyl 5-[[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]amino]thiophene-2-carboxylate (PubChem CID 38934348) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is methyl 5-[[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 5-[[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 38934348 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | methyl 5-[[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H](C)OCc2cccc(OC)c2)s1 |
| InChI | InChI=1S/C17H19NO5S/c1-11(23-10-12-5-4-6-13(9-12)21-2)16(19)18-15-8-7-14(24-15)17(20)22-3/h4-9,11H,10H2,1-3H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | BARYTNPWHSEILQ-LLVKDONJSA-N |
| XLogP | 3.09 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |