C32H34N4O3S — CID 3894765
N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide (PubChem CID 3894765) has the molecular formula C32H34N4O3S and a molecular weight of 554.72 g/mol. Its IUPAC name is N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 3894765 |
| Molecular Formula | C32H34N4O3S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | N-[4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]-2-[(4,5-diphenyl-1,3-oxazol-2-yl)sulfanyl]acetamide |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(NC(=O)CSc3nc(-c4ccccc4)c(-c4ccccc4)o3)cc2)CC1 |
| InChI | InChI=1S/C32H34N4O3S/c1-32(2,3)30(38)36-20-18-35(19-21-36)26-16-14-25(15-17-26)33-27(37)22-40-31-34-28(23-10-6-4-7-11-23)29(39-31)24-12-8-5-9-13-24/h4-17H,18-22H2,1-3H3,(H,33,37) |
| InChIKey | NYVAWGDYFQMRED-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|