C25H31N3O3 — CID 3895128
N-benzyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 3895128) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-benzyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-benzyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 3895128 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-benzyl-N-[2-[[2-(3-methylanilino)-2-oxoethyl]amino]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)CN(Cc2ccccc2)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-19-9-8-14-22(15-19)27-23(29)16-26-24(30)18-28(17-20-10-4-2-5-11-20)25(31)21-12-6-3-7-13-21/h2,4-5,8-11,14-15,21H,3,6-7,12-13,16-18H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | YZQXXVDSCWGFBR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |