C25H27N3O2S — CID 5272491
N-benzyl-N-[2-oxo-2-[4-(1,3-thiazol-4-yl)anilino]ethyl]cyclohexanecarboxamide (PubChem CID 5272491) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is N-benzyl-N-[2-oxo-2-[4-(1,3-thiazol-4-yl)anilino]ethyl]cyclohexanecarboxamide.
| Compound Name | N-benzyl-N-[2-oxo-2-[4-(1,3-thiazol-4-yl)anilino]ethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 5272491 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-benzyl-N-[2-oxo-2-[4-(1,3-thiazol-4-yl)anilino]ethyl]cyclohexanecarboxamide |
| SMILES | O=C(CN(Cc1ccccc1)C(=O)C1CCCCC1)Nc1ccc(-c2cscn2)cc1 |
| InChI | InChI=1S/C25H27N3O2S/c29-24(27-22-13-11-20(12-14-22)23-17-31-18-26-23)16-28(15-19-7-3-1-4-8-19)25(30)21-9-5-2-6-10-21/h1,3-4,7-8,11-14,17-18,21H,2,5-6,9-10,15-16H2,(H,27,29) |
| InChIKey | TUYSUWYQDTYHBS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |