C23H19BrN2O3 — CID 38956965
N-(2-benzylphenyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide (PubChem CID 38956965) has the molecular formula C23H19BrN2O3 and a molecular weight of 451.32 g/mol. Its IUPAC name is N-(2-benzylphenyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide.
| Compound Name | N-(2-benzylphenyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide |
|---|---|
| PubChem CID | 38956965 |
| Molecular Formula | C23H19BrN2O3 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | N-(2-benzylphenyl)-2-(7-bromo-3-oxo-1,4-benzoxazin-4-yl)acetamide |
| SMILES | O=C(CN1C(=O)COc2cc(Br)ccc21)Nc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C23H19BrN2O3/c24-18-10-11-20-21(13-18)29-15-23(28)26(20)14-22(27)25-19-9-5-4-8-17(19)12-16-6-2-1-3-7-16/h1-11,13H,12,14-15H2,(H,25,27) |
| InChIKey | KCXXXTUDNQKPSW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |