C16H16N2O3S — CID 38960523
N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 38960523) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 38960523 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | C[C@@H](NC(=O)Cc1cccs1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C16H16N2O3S/c1-10(17-15(19)8-12-3-2-6-22-12)11-4-5-14-13(7-11)18-16(20)9-21-14/h2-7,10H,8-9H2,1H3,(H,17,19)(H,18,20)/t10-/m1/s1 |
| InChIKey | YCHCUBKACCDAEO-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |